C11H10F6O6S2 — CID 166468774
[2-phenyl-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate (PubChem CID 166468774) has the molecular formula C11H10F6O6S2 and a molecular weight of 416.32 g/mol. Its IUPAC name is [2-phenyl-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate.
| Compound Name | [2-phenyl-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166468774 |
| Molecular Formula | C11H10F6O6S2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | [2-phenyl-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(COS(=O)(=O)C(F)(F)F)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F6O6S2/c12-10(13,14)24(18,19)22-6-9(8-4-2-1-3-5-8)7-23-25(20,21)11(15,16)17/h1-5,9H,6-7H2 |
| InChIKey | OWUYJVXPBLSWMK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|