C6H5F9O9S3 — CID 176596575
2,3-bis(trifluoromethylsulfonyloxy)propyl trifluoromethanesulfonate (PubChem CID 176596575) has the molecular formula C6H5F9O9S3 and a molecular weight of 488.28 g/mol. Its IUPAC name is 2,3-bis(trifluoromethylsulfonyloxy)propyl trifluoromethanesulfonate.
| Compound Name | 2,3-bis(trifluoromethylsulfonyloxy)propyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176596575 |
| Molecular Formula | C6H5F9O9S3 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 487.90 |
| IUPAC Name | 2,3-bis(trifluoromethylsulfonyloxy)propyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(COS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9O9S3/c7-4(8,9)25(16,17)22-1-3(24-27(20,21)6(13,14)15)2-23-26(18,19)5(10,11)12/h3H,1-2H2 |
| InChIKey | VBXNURWDGAPLTM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|