About [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate
[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate (PubChem CID 11059811) has the molecular formula C12H22F3IO4SSi
and a molecular weight of 474.36 g/mol. Its IUPAC name is [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate |
| PubChem CID | 11059811 |
| Molecular Formula | C12H22F3IO4SSi |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C/C=C/I)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H22F3IO4SSi/c1-11(2,3)22(4,5)20-10(7-6-8-16)9-19-21(17,18)12(13,14)15/h6,8,10H,7,9H2,1-5H3/b8-6+/t10-/m1/s1 |
| InChIKey | ZZGRPXUPXYIZRU-QEHWCHDUSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate?
The IUPAC name of [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate (CID 11059811) is [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate.
What is the SMILES notation for [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate?
The canonical SMILES for [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate is CC(C)(C)[Si](C)(C)O[C@H](C/C=C/I)COS(=O)(=O)C(F)(F)F.
What is the InChIKey of [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate?
The InChIKey is ZZGRPXUPXYIZRU-QEHWCHDUSA-N. The full InChI is InChI=1S/C12H22F3IO4SSi/c1-11(2,3)22(4,5)20-10(7-6-8-16)9-19-21(17,18)12(13,14)15/h6,8,10H,7,9H2,1-5H3/b8-6+/t10-/m1/s1.
What are the key properties of [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate?
[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate has a molecular weight of 474.36 g/mol, XLogP of 4.58, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl] trifluoromethanesulfonate is sourced from PubChem (CID 11059811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).