C20H38ClNO2Si — CID 58139601
(3S,6Z,9R,11E)-3-amino-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2-methyltrideca-6,11-dien-4-one (PubChem CID 58139601) has the molecular formula C20H38ClNO2Si and a molecular weight of 388.07 g/mol. Its IUPAC name is (3S,6Z,9R,11E)-3-amino-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2-methyltrideca-6,11-dien-4-one.
| Compound Name | (3S,6Z,9R,11E)-3-amino-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2-methyltrideca-6,11-dien-4-one |
|---|---|
| PubChem CID | 58139601 |
| Molecular Formula | C20H38ClNO2Si |
| Molecular Weight | 388.07 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (3S,6Z,9R,11E)-3-amino-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2-methyltrideca-6,11-dien-4-one |
| SMILES | C/C(Cl)=C\C[C@@H](C/C=C\CC(=O)[C@@H](N)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38ClNO2Si/c1-15(2)19(22)18(23)12-10-9-11-17(14-13-16(3)21)24-25(7,8)20(4,5)6/h9-10,13,15,17,19H,11-12,14,22H2,1-8H3/b10-9-,16-13+/t17-,19+/m1/s1 |
| InChIKey | ANTCRRVJRFTUBB-IPPSFGBWSA-N |
| XLogP | 5.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.07 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|