C22H37ClN2O3Si — CID 91867805
(2S)-N-[(1Z,4R,6E)-4-[tert-butyl(dimethyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3-methyl-2-(prop-2-ynoylamino)butanamide (PubChem CID 91867805) has the molecular formula C22H37ClN2O3Si and a molecular weight of 441.09 g/mol. Its IUPAC name is (2S)-N-[(1Z,4R,6E)-4-[tert-butyl(dimethyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3-methyl-2-(prop-2-ynoylamino)butanamide.
| Compound Name | (2S)-N-[(1Z,4R,6E)-4-[tert-butyl(dimethyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3-methyl-2-(prop-2-ynoylamino)butanamide |
|---|---|
| PubChem CID | 91867805 |
| Molecular Formula | C22H37ClN2O3Si |
| Molecular Weight | 441.09 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (2S)-N-[(1Z,4R,6E)-4-[tert-butyl(dimethyl)silyl]oxy-7-chloroocta-1,6-dienyl]-3-methyl-2-(prop-2-ynoylamino)butanamide |
| SMILES | C#CC(=O)N[C@H](C(=O)N/C=C\C[C@H](C/C=C(\C)Cl)O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H37ClN2O3Si/c1-10-19(26)25-20(16(2)3)21(27)24-15-11-12-18(14-13-17(4)23)28-29(8,9)22(5,6)7/h1,11,13,15-16,18,20H,12,14H2,2-9H3,(H,24,27)(H,25,26)/b15-11-,17-13+/t18-,20+/m1/s1 |
| InChIKey | PGFNAQBXFASXHP-RWQJTDPYSA-N |
| XLogP | 4.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.09 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|