C26H42ClNO3Si — CID 58139641
(E)-N-[(3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide (PubChem CID 58139641) has the molecular formula C26H42ClNO3Si and a molecular weight of 480.17 g/mol. Its IUPAC name is (E)-N-[(3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide.
| Compound Name | (E)-N-[(3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide |
|---|---|
| PubChem CID | 58139641 |
| Molecular Formula | C26H42ClNO3Si |
| Molecular Weight | 480.17 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (E)-N-[(3S,6Z,9R,11E)-9-[tert-butyl(dimethyl)silyl]oxy-12-chloro-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide |
| SMILES | C#C/C=C/C(=O)N[C@H](C(=O)C/C=C\C[C@H](C/C=C(\C)Cl)O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H42ClNO3Si/c1-11-12-17-23(30)28-24(25(3,4)5)22(29)16-14-13-15-21(19-18-20(2)27)31-32(9,10)26(6,7)8/h1,12-14,17-18,21,24H,15-16,19H2,2-10H3,(H,28,30)/b14-13-,17-12+,20-18+/t21-,24-/m1/s1 |
| InChIKey | ODQDZQRFUGJLNH-ZPUPQPEVSA-N |
| XLogP | 6.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.17 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|