C21H41NO2Si — CID 88857389
(2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxyocta-1,6-dienyl]-2,3,3-trimethylbutanamide (PubChem CID 88857389) has the molecular formula C21H41NO2Si and a molecular weight of 367.65 g/mol. Its IUPAC name is (2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxyocta-1,6-dienyl]-2,3,3-trimethylbutanamide.
| Compound Name | (2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxyocta-1,6-dienyl]-2,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 88857389 |
| Molecular Formula | C21H41NO2Si |
| Molecular Weight | 367.65 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxyocta-1,6-dienyl]-2,3,3-trimethylbutanamide |
| SMILES | C/C=C\C[C@@H](C/C=C\NC(=O)[C@@H](C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41NO2Si/c1-11-12-14-18(24-25(9,10)21(6,7)8)15-13-16-22-19(23)17(2)20(3,4)5/h11-13,16-18H,14-15H2,1-10H3,(H,22,23)/b12-11-,16-13-/t17-,18+/m1/s1 |
| InChIKey | AIKCBYMUWFMOTC-JWBGIMEXSA-N |
| XLogP | 6.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|