C35H52N2O4Si — CID 91012273
tert-butyl N-[(2S)-1-[[(4S)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 91012273) has the molecular formula C35H52N2O4Si and a molecular weight of 592.90 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(4S)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(4S)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 91012273 |
| Molecular Formula | C35H52N2O4Si |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.37 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(4S)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC=CC[C@@H](CC=CNC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H52N2O4Si/c1-11-12-20-27(21-19-26-36-31(38)30(33(2,3)4)37-32(39)40-34(5,6)7)41-42(35(8,9)10,28-22-15-13-16-23-28)29-24-17-14-18-25-29/h11-19,22-27,30H,20-21H2,1-10H3,(H,36,38)(H,37,39)/t27-,30+/m0/s1 |
| InChIKey | HELVXNZLPXADBC-BHBYDHKZSA-N |
| XLogP | 6.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|