C25H34OSi — CID 58139640
tert-butyl-[(2Z,7Z)-nona-2,7-dien-5-yl]oxy-diphenylsilane (PubChem CID 58139640) has the molecular formula C25H34OSi and a molecular weight of 378.63 g/mol. Its IUPAC name is tert-butyl-[(2Z,7Z)-nona-2,7-dien-5-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2Z,7Z)-nona-2,7-dien-5-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 58139640 |
| Molecular Formula | C25H34OSi |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | tert-butyl-[(2Z,7Z)-nona-2,7-dien-5-yl]oxy-diphenylsilane |
| SMILES | C/C=C\CC(C/C=C\C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34OSi/c1-6-8-16-22(17-9-7-2)26-27(25(3,4)5,23-18-12-10-13-19-23)24-20-14-11-15-21-24/h6-15,18-22H,16-17H2,1-5H3/b8-6-,9-7- |
| InChIKey | LUZKAKPKHBNUJE-VRHVFUOLSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|