C20H23F3O2Si — CID 91243665
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanal (PubChem CID 91243665) has the molecular formula C20H23F3O2Si and a molecular weight of 380.48 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanal.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanal |
|---|---|
| PubChem CID | 91243665 |
| Molecular Formula | C20H23F3O2Si |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanal |
| SMILES | CC(C)(C)[Si](O[C@@H](CC=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23F3O2Si/c1-19(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)25-18(14-15-24)20(21,22)23/h4-13,15,18H,14H2,1-3H3/t18-/m0/s1 |
| InChIKey | XBCMOQKCWWKALY-SFHVURJKSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|