C37H44BrFO3Si2 — CID 162159543
(3R,4S)-4-bromo-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-fluoropentanal (PubChem CID 162159543) has the molecular formula C37H44BrFO3Si2 and a molecular weight of 691.83 g/mol. Its IUPAC name is (3R,4S)-4-bromo-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-fluoropentanal.
| Compound Name | (3R,4S)-4-bromo-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-fluoropentanal |
|---|---|
| PubChem CID | 162159543 |
| Molecular Formula | C37H44BrFO3Si2 |
| Molecular Weight | 691.83 g/mol |
| Exact Mass | 690.20 |
| IUPAC Name | (3R,4S)-4-bromo-3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-fluoropentanal |
| SMILES | CC(C)(C)[Si](OC[C@H](Br)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(F)C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H44BrFO3Si2/c1-36(2,3)43(29-19-11-7-12-20-29,30-21-13-8-14-22-30)41-28-33(38)35(34(39)27-40)42-44(37(4,5)6,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h7-27,33-35H,28H2,1-6H3/t33-,34?,35-/m0/s1 |
| InChIKey | ZMHDKEJGQDCJQD-LZSYXLHYSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.83 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|