C24H32O2Si — CID 11574459
(2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-4-methylpentanal (PubChem CID 11574459) has the molecular formula C24H32O2Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-4-methylpentanal.
| Compound Name | (2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-4-methylpentanal |
|---|---|
| PubChem CID | 11574459 |
| Molecular Formula | C24H32O2Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-4-methylpentanal |
| SMILES | C=C[C@@H](C=O)C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32O2Si/c1-6-21(18-25)17-20(2)19-26-27(24(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h6-16,18,20-21H,1,17,19H2,2-5H3/t20-,21+/m0/s1 |
| InChIKey | RQRQUELRVWBBNK-LEWJYISDSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|