C23H32O3SSi — CID 145359346
(2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]hex-5-ene-2-sulfinic acid (PubChem CID 145359346) has the molecular formula C23H32O3SSi and a molecular weight of 416.66 g/mol. Its IUPAC name is (2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]hex-5-ene-2-sulfinic acid.
| Compound Name | (2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]hex-5-ene-2-sulfinic acid |
|---|---|
| PubChem CID | 145359346 |
| Molecular Formula | C23H32O3SSi |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2R,4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]hex-5-ene-2-sulfinic acid |
| SMILES | C=C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](C)S(=O)O |
| InChI | InChI=1S/C23H32O3SSi/c1-6-20(17-19(2)27(24)25)18-26-28(23(3,4)5,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h6-16,19-20H,1,17-18H2,2-5H3,(H,24,25)/t19-,20-/m1/s1 |
| InChIKey | GYINAPJOFQPXCT-WOJBJXKFSA-N |
| XLogP | 4.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|