C24H34O2Si — CID 132510490
(4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-1-en-4-ol (PubChem CID 132510490) has the molecular formula C24H34O2Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-1-en-4-ol.
| Compound Name | (4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 132510490 |
| Molecular Formula | C24H34O2Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-6-methylhept-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34O2Si/c1-6-13-21(25)18-20(2)19-26-27(24(3,4)5,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h6-12,14-17,20-21,25H,1,13,18-19H2,2-5H3/t20-,21-/m0/s1 |
| InChIKey | PXNLZVLPJBBYFI-SFTDATJTSA-N |
| XLogP | 4.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|