C25H38O4Si — CID 71514828
(2S,4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-6-methylheptane-1,2-diol (PubChem CID 71514828) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (2S,4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-6-methylheptane-1,2-diol.
| Compound Name | (2S,4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-6-methylheptane-1,2-diol |
|---|---|
| PubChem CID | 71514828 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (2S,4S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-6-methylheptane-1,2-diol |
| SMILES | CO[C@@H](C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](O)CO |
| InChI | InChI=1S/C25H38O4Si/c1-20(16-22(28-5)17-21(27)18-26)19-29-30(25(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,20-22,26-27H,16-19H2,1-5H3/t20-,21-,22-/m0/s1 |
| InChIKey | XUZOLFANIHXSDO-FKBYEOEOSA-N |
| XLogP | 3.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|