C26H40O4Si — CID 71504117
(4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-6-methylheptan-1-ol (PubChem CID 71504117) has the molecular formula C26H40O4Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-6-methylheptan-1-ol.
| Compound Name | (4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-6-methylheptan-1-ol |
|---|---|
| PubChem CID | 71504117 |
| Molecular Formula | C26H40O4Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)-6-methylheptan-1-ol |
| SMILES | COCO[C@H](CCCO)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H40O4Si/c1-22(19-23(13-12-18-27)29-21-28-5)20-30-31(26(2,3)4,24-14-8-6-9-15-24)25-16-10-7-11-17-25/h6-11,14-17,22-23,27H,12-13,18-21H2,1-5H3/t22-,23-/m1/s1 |
| InChIKey | MTFGFMALUBOZPX-DHIUTWEWSA-N |
| XLogP | 4.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|