C40H68O3Si — CID 134846014
tert-butyl-[(2R,4R,6R,8S,10S,12S,14S)-15-(methoxymethoxy)-2,4,6,8,10,12,14-heptamethylpentadecoxy]-diphenylsilane (PubChem CID 134846014) has the molecular formula C40H68O3Si and a molecular weight of 625.07 g/mol. Its IUPAC name is tert-butyl-[(2R,4R,6R,8S,10S,12S,14S)-15-(methoxymethoxy)-2,4,6,8,10,12,14-heptamethylpentadecoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,4R,6R,8S,10S,12S,14S)-15-(methoxymethoxy)-2,4,6,8,10,12,14-heptamethylpentadecoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134846014 |
| Molecular Formula | C40H68O3Si |
| Molecular Weight | 625.07 g/mol |
| Exact Mass | 624.49 |
| IUPAC Name | tert-butyl-[(2R,4R,6R,8S,10S,12S,14S)-15-(methoxymethoxy)-2,4,6,8,10,12,14-heptamethylpentadecoxy]-diphenylsilane |
| SMILES | COCOC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@H](C)C[C@@H](C)C[C@@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H68O3Si/c1-31(22-32(2)24-34(4)26-36(6)28-42-30-41-11)23-33(3)25-35(5)27-37(7)29-43-44(40(8,9)10,38-18-14-12-15-19-38)39-20-16-13-17-21-39/h12-21,31-37H,22-30H2,1-11H3/t31-,32-,33+,34-,35+,36-,37+/m0/s1 |
| InChIKey | QXXLGSKKNWBWSE-KRECSZAMSA-N |
| XLogP | 9.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.07 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|