C35H50O5Si — CID 11353695
(2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)-3,7-dimethyl-2-phenylmethoxyoctan-3-ol (PubChem CID 11353695) has the molecular formula C35H50O5Si and a molecular weight of 578.87 g/mol. Its IUPAC name is (2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)-3,7-dimethyl-2-phenylmethoxyoctan-3-ol.
| Compound Name | (2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)-3,7-dimethyl-2-phenylmethoxyoctan-3-ol |
|---|---|
| PubChem CID | 11353695 |
| Molecular Formula | C35H50O5Si |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | (2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)-3,7-dimethyl-2-phenylmethoxyoctan-3-ol |
| SMILES | COCOC[C@@H](OCc1ccccc1)[C@@](C)(O)CCCC(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H50O5Si/c1-29(17-16-24-35(5,36)33(27-38-28-37-6)39-26-30-18-10-7-11-19-30)25-40-41(34(2,3)4,31-20-12-8-13-21-31)32-22-14-9-15-23-32/h7-15,18-23,29,33,36H,16-17,24-28H2,1-6H3/t29?,33-,35+/m1/s1 |
| InChIKey | GZGVSTFFGGLOQU-RZJLRSEESA-N |
| XLogP | 6.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|