C30H40OSi — CID 134925581
tert-butyl-[(2S,5S)-2,5-dimethyl-6-phenylhexoxy]-diphenylsilane (PubChem CID 134925581) has the molecular formula C30H40OSi and a molecular weight of 444.74 g/mol. Its IUPAC name is tert-butyl-[(2S,5S)-2,5-dimethyl-6-phenylhexoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,5S)-2,5-dimethyl-6-phenylhexoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134925581 |
| Molecular Formula | C30H40OSi |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | tert-butyl-[(2S,5S)-2,5-dimethyl-6-phenylhexoxy]-diphenylsilane |
| SMILES | C[C@@H](CC[C@H](C)Cc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H40OSi/c1-25(23-27-15-9-6-10-16-27)21-22-26(2)24-31-32(30(3,4)5,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-20,25-26H,21-24H2,1-5H3/t25-,26-/m0/s1 |
| InChIKey | JWDUJJCIFIMCGT-UIOOFZCWSA-N |
| XLogP | 6.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|