C45H60O8SSi — CID 154414473
[2-[9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-4,8-dimethyl-3-phenylmethoxynonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 154414473) has the molecular formula C45H60O8SSi and a molecular weight of 789.12 g/mol. Its IUPAC name is [2-[9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-4,8-dimethyl-3-phenylmethoxynonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [2-[9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-4,8-dimethyl-3-phenylmethoxynonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154414473 |
| Molecular Formula | C45H60O8SSi |
| Molecular Weight | 789.12 g/mol |
| Exact Mass | 788.38 |
| IUPAC Name | [2-[9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-4,8-dimethyl-3-phenylmethoxynonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(CCC(OCc3ccccc3)C(C)(O)CCCC(C)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OCCO2)cc1 |
| InChI | InChI=1S/C45H60O8SSi/c1-36-24-26-39(27-25-36)54(47,48)52-35-45(50-31-32-51-45)30-28-42(49-34-38-18-10-7-11-19-38)44(6,46)29-16-17-37(2)33-53-55(43(3,4)5,40-20-12-8-13-21-40)41-22-14-9-15-23-41/h7-15,18-27,37,42,46H,16-17,28-35H2,1-6H3 |
| InChIKey | YAMCKCCCEVGALQ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.12 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|