C27H34ClNO3SSi — CID 102306083
N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-chlorobutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 102306083) has the molecular formula C27H34ClNO3SSi and a molecular weight of 516.18 g/mol. Its IUPAC name is N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-chlorobutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-chlorobutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102306083 |
| Molecular Formula | C27H34ClNO3SSi |
| Molecular Weight | 516.18 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-chlorobutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)[C@@H](Cl)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H34ClNO3SSi/c1-21-16-18-23(19-17-21)33(30,31)29-22(2)26(28)20-32-34(27(3,4)5,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-19,22,26,29H,20H2,1-5H3/t22-,26-/m0/s1 |
| InChIKey | MATXCJXUFVDBGB-NVQXNPDNSA-N |
| XLogP | 4.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|