C34H39NO3SSi — CID 101455227
N-[(E,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylpent-1-en-3-yl]-4-methylbenzenesulfonamide (PubChem CID 101455227) has the molecular formula C34H39NO3SSi and a molecular weight of 569.84 g/mol. Its IUPAC name is N-[(E,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylpent-1-en-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylpent-1-en-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101455227 |
| Molecular Formula | C34H39NO3SSi |
| Molecular Weight | 569.84 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | N-[(E,3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-phenylpent-1-en-3-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](/C=C/c2ccccc2)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H39NO3SSi/c1-28-20-24-31(25-21-28)39(36,37)35-30(23-22-29-14-8-5-9-15-29)26-27-38-40(34(2,3)4,32-16-10-6-11-17-32)33-18-12-7-13-19-33/h5-25,30,35H,26-27H2,1-4H3/b23-22+/t30-/m1/s1 |
| InChIKey | UNLVXQICPDSEHA-PIKQWGIYSA-N |
| XLogP | 6.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.84 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|