C31H41NO4SSi — CID 12964130
N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 12964130) has the molecular formula C31H41NO4SSi and a molecular weight of 551.83 g/mol. Its IUPAC name is N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 12964130 |
| Molecular Formula | C31H41NO4SSi |
| Molecular Weight | 551.83 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-(hydroxymethyl)hept-6-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C=CC[C@@H](CO)C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H41NO4SSi/c1-6-13-26(23-33)22-27(32-37(34,35)28-20-18-25(2)19-21-28)24-36-38(31(3,4)5,29-14-9-7-10-15-29)30-16-11-8-12-17-30/h6-12,14-21,26-27,32-33H,1,13,22-24H2,2-5H3/t26-,27+/m1/s1 |
| InChIKey | GTTKEZHLFWIZJV-SXOMAYOGSA-N |
| XLogP | 4.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|