C34H46BrNO4SSi — CID 11767565
N-[12-bromo-1-[tert-butyl(diphenyl)silyl]oxy-3-oxododecan-2-yl]benzenesulfonamide (PubChem CID 11767565) has the molecular formula C34H46BrNO4SSi and a molecular weight of 672.80 g/mol. Its IUPAC name is N-[12-bromo-1-[tert-butyl(diphenyl)silyl]oxy-3-oxododecan-2-yl]benzenesulfonamide.
| Compound Name | N-[12-bromo-1-[tert-butyl(diphenyl)silyl]oxy-3-oxododecan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11767565 |
| Molecular Formula | C34H46BrNO4SSi |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 671.21 |
| IUPAC Name | N-[12-bromo-1-[tert-butyl(diphenyl)silyl]oxy-3-oxododecan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(C)[Si](OCC(NS(=O)(=O)c1ccccc1)C(=O)CCCCCCCCCBr)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H46BrNO4SSi/c1-34(2,3)42(30-22-14-10-15-23-30,31-24-16-11-17-25-31)40-28-32(36-41(38,39)29-20-12-9-13-21-29)33(37)26-18-7-5-4-6-8-19-27-35/h9-17,20-25,32,36H,4-8,18-19,26-28H2,1-3H3 |
| InChIKey | LIJDMBVKSYVBGL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|