C20H27NO3Si — CID 86196394
3-[tert-butyl(diphenyl)silyl]oxy-2-(methylamino)propanoic acid (PubChem CID 86196394) has the molecular formula C20H27NO3Si and a molecular weight of 357.53 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-2-(methylamino)propanoic acid.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 86196394 |
| Molecular Formula | C20H27NO3Si |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-2-(methylamino)propanoic acid |
| SMILES | CNC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H27NO3Si/c1-20(2,3)25(16-11-7-5-8-12-16,17-13-9-6-10-14-17)24-15-18(21-4)19(22)23/h5-14,18,21H,15H2,1-4H3,(H,22,23) |
| InChIKey | BFTVGHHJNAMBIP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|