C18H22O3Si — CID 11141564
2-[tert-butyl(diphenyl)silyl]oxyacetic acid (PubChem CID 11141564) has the molecular formula C18H22O3Si and a molecular weight of 314.46 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxyacetic acid.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxyacetic acid |
|---|---|
| PubChem CID | 11141564 |
| Molecular Formula | C18H22O3Si |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxyacetic acid |
| SMILES | CC(C)(C)[Si](OCC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22O3Si/c1-18(2,3)22(21-14-17(19)20,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3,(H,19,20) |
| InChIKey | AHVZUDBOTZUEOO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|