C26H36O2Si — CID 90097927
2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethanone (PubChem CID 90097927) has the molecular formula C26H36O2Si and a molecular weight of 408.66 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethanone.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 90097927 |
| Molecular Formula | C26H36O2Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethanone |
| SMILES | C[C@@H]1CC[C@H](C(=O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C26H36O2Si/c1-20-17-18-23(26(20,5)6)24(27)19-28-29(25(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23H,17-19H2,1-6H3/t20-,23-/m1/s1 |
| InChIKey | UCUXXBNXDHDWBM-NFBKMPQASA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|