C23H31O3SSi+ — CID 172826315
1-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxythiolan-1-ium-1-yl]ethanone (PubChem CID 172826315) has the molecular formula C23H31O3SSi+ and a molecular weight of 415.65 g/mol. Its IUPAC name is 1-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxythiolan-1-ium-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxythiolan-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 172826315 |
| Molecular Formula | C23H31O3SSi+ |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxythiolan-1-ium-1-yl]ethanone |
| SMILES | CC(=O)[S+]1C(O)CC[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H31O3SSi/c1-18(24)27-19(15-16-22(27)25)17-26-28(23(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22,25H,15-17H2,1-4H3/q+1/t19-,22?,27?/m0/s1 |
| InChIKey | UXICGBUPHPTIDZ-JIUXCQJLSA-N |
| XLogP | 3.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|