C22H29NO4Si — CID 175419157
(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylic acid (PubChem CID 175419157) has the molecular formula C22H29NO4Si and a molecular weight of 399.56 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175419157 |
| Molecular Formula | C22H29NO4Si |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](OC[C@H]1CCC(O)N1C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO4Si/c1-22(2,3)28(18-10-6-4-7-11-18,19-12-8-5-9-13-19)27-16-17-14-15-20(24)23(17)21(25)26/h4-13,17,20,24H,14-16H2,1-3H3,(H,25,26)/t17-,20?/m1/s1 |
| InChIKey | FUDPNTLESBJDIS-DIAVIDTQSA-N |
| XLogP | 3.02 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|