C22H29NO3Si — CID 177426805
tert-butyl-[[(2S)-5-methoxy-6-oxa-1-azabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane (PubChem CID 177426805) has the molecular formula C22H29NO3Si and a molecular weight of 383.56 g/mol. Its IUPAC name is tert-butyl-[[(2S)-5-methoxy-6-oxa-1-azabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S)-5-methoxy-6-oxa-1-azabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 177426805 |
| Molecular Formula | C22H29NO3Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | tert-butyl-[[(2S)-5-methoxy-6-oxa-1-azabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane |
| SMILES | COC12CC[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)N1O2 |
| InChI | InChI=1S/C22H29NO3Si/c1-21(2,3)27(19-11-7-5-8-12-19,20-13-9-6-10-14-20)25-17-18-15-16-22(24-4)23(18)26-22/h5-14,18H,15-17H2,1-4H3/t18-,22?,23?/m0/s1 |
| InChIKey | SGCVJKXBUAYJJG-NWLLBJEDSA-N |
| XLogP | 3.27 |
| TPSA | 34.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|