C33H41NO5Si — CID 140831183
1-O-benzyl 3-O-methyl (3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpiperidine-1,3-dicarboxylate (PubChem CID 140831183) has the molecular formula C33H41NO5Si and a molecular weight of 559.78 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl (3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl (3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 140831183 |
| Molecular Formula | C33H41NO5Si |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 1-O-benzyl 3-O-methyl (3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpiperidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C)CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C33H41NO5Si/c1-32(2,3)40(28-17-11-7-12-18-28,29-19-13-8-14-20-29)39-24-27-21-22-33(4,30(35)37-5)25-34(27)31(36)38-23-26-15-9-6-10-16-26/h6-20,27H,21-25H2,1-5H3/t27-,33+/m1/s1 |
| InChIKey | VYIOOKXBTUSIHN-SYBRLPANSA-N |
| XLogP | 5.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|