C33H41NO4Si — CID 11671123
benzyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-2-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 11671123) has the molecular formula C33H41NO4Si and a molecular weight of 543.78 g/mol. Its IUPAC name is benzyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-2-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-2-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11671123 |
| Molecular Formula | C33H41NO4Si |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | benzyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-2-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | C=C[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OCc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C33H41NO4Si/c1-5-27-21-22-28(34(31(27)23-35)32(36)37-24-26-15-9-6-10-16-26)25-38-39(33(2,3)4,29-17-11-7-12-18-29)30-19-13-8-14-20-30/h5-20,27-28,31,35H,1,21-25H2,2-4H3/t27-,28+,31+/m1/s1 |
| InChIKey | IWTGDARUWKGYTG-XHWIWGEHSA-N |
| XLogP | 5.53 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|