C29H41NO3Si — CID 101384187
tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 101384187) has the molecular formula C29H41NO3Si and a molecular weight of 479.74 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101384187 |
| Molecular Formula | C29H41NO3Si |
| Molecular Weight | 479.74 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41NO3Si/c1-8-15-23-20-21-24(30(23)27(31)33-28(2,3)4)22-32-34(29(5,6)7,25-16-11-9-12-17-25)26-18-13-10-14-19-26/h8-14,16-19,23-24H,1,15,20-22H2,2-7H3/t23-,24+/m1/s1 |
| InChIKey | JZYCFBWUWBFKRH-RPWUZVMVSA-N |
| XLogP | 5.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.74 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|