C31H43N3O3Si — CID 158982369
tert-butyl (2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-1-cyano-2-(dimethylamino)ethenyl]pyrrolidine-1-carboxylate (PubChem CID 158982369) has the molecular formula C31H43N3O3Si and a molecular weight of 533.79 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-1-cyano-2-(dimethylamino)ethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-1-cyano-2-(dimethylamino)ethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158982369 |
| Molecular Formula | C31H43N3O3Si |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | tert-butyl (2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-1-cyano-2-(dimethylamino)ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C)/C=C(/C#N)[C@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H43N3O3Si/c1-30(2,3)37-29(35)34-25(19-20-28(34)24(21-32)22-33(7)8)23-36-38(31(4,5)6,26-15-11-9-12-16-26)27-17-13-10-14-18-27/h9-18,22,25,28H,19-20,23H2,1-8H3/b24-22-/t25-,28+/m0/s1 |
| InChIKey | VUELUIMCWPGKTM-RGCPWVFBSA-N |
| XLogP | 5.30 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|