C28H37NO4Si — CID 142989267
tert-butyl (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyl-2-hydroxypyrrolidine-1-carboxylate (PubChem CID 142989267) has the molecular formula C28H37NO4Si and a molecular weight of 479.69 g/mol. Its IUPAC name is tert-butyl (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyl-2-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyl-2-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142989267 |
| Molecular Formula | C28H37NO4Si |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | tert-butyl (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyl-2-hydroxypyrrolidine-1-carboxylate |
| SMILES | C#CC1(O)CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37NO4Si/c1-8-28(31)20-19-22(29(28)25(30)33-26(2,3)4)21-32-34(27(5,6)7,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h1,9-18,22,31H,19-21H2,2-7H3/t22-,28?/m0/s1 |
| InChIKey | TXPIJJSLSVYXIA-XYXHBKGXSA-N |
| XLogP | 4.28 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|