C30H39NO7Si — CID 11261404
2-O-ethoxycarbonyl 1-O-methyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenylpiperidine-1,2-dicarboxylate (PubChem CID 11261404) has the molecular formula C30H39NO7Si and a molecular weight of 553.73 g/mol. Its IUPAC name is 2-O-ethoxycarbonyl 1-O-methyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenylpiperidine-1,2-dicarboxylate.
| Compound Name | 2-O-ethoxycarbonyl 1-O-methyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenylpiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11261404 |
| Molecular Formula | C30H39NO7Si |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 2-O-ethoxycarbonyl 1-O-methyl (2R,3S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenylpiperidine-1,2-dicarboxylate |
| SMILES | C=C[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC)[C@H]1C(=O)OC(=O)OCC |
| InChI | InChI=1S/C30H39NO7Si/c1-7-22-19-20-23(31(28(33)35-6)26(22)27(32)38-29(34)36-8-2)21-37-39(30(3,4)5,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h7,9-18,22-23,26H,1,8,19-21H2,2-6H3/t22-,23+,26-/m1/s1 |
| InChIKey | VXASITATKLBSHV-MVERNJQCSA-N |
| XLogP | 4.66 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|