C29H41NO6Si — CID 140876036
4-O-tert-butyl 2-O-ethyl (6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]morpholine-2,4-dicarboxylate (PubChem CID 140876036) has the molecular formula C29H41NO6Si and a molecular weight of 527.73 g/mol. Its IUPAC name is 4-O-tert-butyl 2-O-ethyl (6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]morpholine-2,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 2-O-ethyl (6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]morpholine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 140876036 |
| Molecular Formula | C29H41NO6Si |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 4-O-tert-butyl 2-O-ethyl (6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]morpholine-2,4-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H41NO6Si/c1-8-33-26(31)25-20-30(27(32)36-28(2,3)4)19-22(35-25)21-34-37(29(5,6)7,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,22,25H,8,19-21H2,1-7H3/t22-,25?/m0/s1 |
| InChIKey | LGZRBAMOEXHEHT-XADRRFQNSA-N |
| XLogP | 4.13 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|