C28H39NO4Si — CID 164534961
tert-butyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylidene-1,4-oxazepane-4-carboxylate (PubChem CID 164534961) has the molecular formula C28H39NO4Si and a molecular weight of 481.71 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylidene-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylidene-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 164534961 |
| Molecular Formula | C28H39NO4Si |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | tert-butyl (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylidene-1,4-oxazepane-4-carboxylate |
| SMILES | C=C1CO[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H39NO4Si/c1-22-18-29(26(30)33-27(2,3)4)19-23(31-20-22)21-32-34(28(5,6)7,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,23H,1,18-21H2,2-7H3/t23-/m1/s1 |
| InChIKey | BCUOLAWGTGEPOU-HSZRJFAPSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|