C23H28N2O2Si — CID 90424169
tert-butyl-[[(6R)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-6-yl]methoxy]-diphenylsilane (PubChem CID 90424169) has the molecular formula C23H28N2O2Si and a molecular weight of 392.58 g/mol. Its IUPAC name is tert-butyl-[[(6R)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-6-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(6R)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-6-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 90424169 |
| Molecular Formula | C23H28N2O2Si |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | tert-butyl-[[(6R)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazin-6-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1Cn2ccnc2CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O2Si/c1-23(2,3)28(20-10-6-4-7-11-20,21-12-8-5-9-13-21)27-17-19-16-25-15-14-24-22(25)18-26-19/h4-15,19H,16-18H2,1-3H3/t19-/m1/s1 |
| InChIKey | CBFWDNLPDFKXAQ-LJQANCHMSA-N |
| XLogP | 3.36 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|