C28H32N4O2Si — CID 175934138
2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 175934138) has the molecular formula C28H32N4O2Si and a molecular weight of 484.68 g/mol. Its IUPAC name is 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 175934138 |
| Molecular Formula | C28H32N4O2Si |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC(C)(C)[Si](OCC1CC=C(c2nc(N)c3cccn3n2)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O2Si/c1-28(2,3)35(23-11-6-4-7-12-23,24-13-8-5-9-14-24)34-20-22-17-16-21(19-33-22)27-30-26(29)25-15-10-18-32(25)31-27/h4-16,18,22H,17,19-20H2,1-3H3,(H2,29,30,31) |
| InChIKey | KXVKYVVCLKFBRP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|