C29H44O7Si — CID 102228442
tert-butyl-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-diphenylsilane (PubChem CID 102228442) has the molecular formula C29H44O7Si and a molecular weight of 532.75 g/mol. Its IUPAC name is tert-butyl-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-diphenylsilane.
| Compound Name | tert-butyl-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-diphenylsilane |
|---|---|
| PubChem CID | 102228442 |
| Molecular Formula | C29H44O7Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | tert-butyl-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC1COCCOCCOCCOCCOCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H44O7Si/c1-29(2,3)37(27-10-6-4-7-11-27,28-12-8-5-9-13-28)36-25-26-24-34-21-20-32-17-16-30-14-15-31-18-19-33-22-23-35-26/h4-13,26H,14-25H2,1-3H3 |
| InChIKey | KMARLZMLPRACDN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|