C22H28O4Si — CID 155658327
4-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2-carboxylic acid (PubChem CID 155658327) has the molecular formula C22H28O4Si and a molecular weight of 384.55 g/mol. Its IUPAC name is 4-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2-carboxylic acid.
| Compound Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 155658327 |
| Molecular Formula | C22H28O4Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](OCC1COC(C(=O)O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O4Si/c1-22(2,3)27(18-10-6-4-7-11-18,19-12-8-5-9-13-19)26-16-17-14-20(21(23)24)25-15-17/h4-13,17,20H,14-16H2,1-3H3,(H,23,24) |
| InChIKey | PBDWMZLHSWAKJO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|