C28H40O4Si — CID 69058871
2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoic acid (PubChem CID 69058871) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is 2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoic acid.
| Compound Name | 2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 69058871 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(OCC1CCC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1)C(=O)O |
| InChI | InChI=1S/C28H40O4Si/c1-27(2,3)33(24-15-8-6-9-16-24,25-17-10-7-11-18-25)32-21-23-14-12-13-22(19-23)20-31-28(4,5)26(29)30/h6-11,15-18,22-23H,12-14,19-21H2,1-5H3,(H,29,30)/t22?,23-/m1/s1 |
| InChIKey | WBXVJHSJBWRJOB-OZAIVSQSSA-N |
| XLogP | 5.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|