C32H48O4Si — CID 69060280
tert-butyl 2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoate (PubChem CID 69060280) has the molecular formula C32H48O4Si and a molecular weight of 524.82 g/mol. Its IUPAC name is tert-butyl 2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 69060280 |
| Molecular Formula | C32H48O4Si |
| Molecular Weight | 524.82 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | tert-butyl 2-[[(3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexyl]methoxy]-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)OCC1CCC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H48O4Si/c1-30(2,3)36-29(33)32(7,8)34-23-25-16-15-17-26(22-25)24-35-37(31(4,5)6,27-18-11-9-12-19-27)28-20-13-10-14-21-28/h9-14,18-21,25-26H,15-17,22-24H2,1-8H3/t25?,26-/m1/s1 |
| InChIKey | OFFPLQOSEAXVNT-FXDYGKIASA-N |
| XLogP | 6.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.82 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|