C22H30O3Si — CID 10981523
[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methanol (PubChem CID 10981523) has the molecular formula C22H30O3Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methanol.
| Compound Name | [(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 10981523 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H](CO)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O3Si/c1-22(2,3)26(20-10-6-4-7-11-20,21-12-8-5-9-13-21)24-17-19-15-14-18(16-23)25-19/h4-13,18-19,23H,14-17H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | RNLUXDWHLUCXAF-MOPGFXCFSA-N |
| XLogP | 3.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|