C26H39O6PSi — CID 59795858
tert-butyl-[[(2R,5R)-5-(diethoxyphosphorylmethoxy)oxolan-2-yl]methoxy]-diphenylsilane (PubChem CID 59795858) has the molecular formula C26H39O6PSi and a molecular weight of 506.65 g/mol. Its IUPAC name is tert-butyl-[[(2R,5R)-5-(diethoxyphosphorylmethoxy)oxolan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,5R)-5-(diethoxyphosphorylmethoxy)oxolan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 59795858 |
| Molecular Formula | C26H39O6PSi |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | tert-butyl-[[(2R,5R)-5-(diethoxyphosphorylmethoxy)oxolan-2-yl]methoxy]-diphenylsilane |
| SMILES | CCOP(=O)(CO[C@@H]1CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1)OCC |
| InChI | InChI=1S/C26H39O6PSi/c1-6-29-33(27,30-7-2)21-28-25-19-18-22(32-25)20-31-34(26(3,4)5,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,22,25H,6-7,18-21H2,1-5H3/t22-,25+/m1/s1 |
| InChIKey | NSTQKXDXAFJVOP-RDGATRHJSA-N |
| XLogP | 5.31 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|