C34H52O4Si — CID 101031088
[(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-decyloxan-3-yl] acetate (PubChem CID 101031088) has the molecular formula C34H52O4Si and a molecular weight of 552.87 g/mol. Its IUPAC name is [(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-decyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-decyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101031088 |
| Molecular Formula | C34H52O4Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | [(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-decyloxan-3-yl] acetate |
| SMILES | CCCCCCCCCC[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H52O4Si/c1-6-7-8-9-10-11-12-19-24-32-33(37-28(2)35)26-25-29(38-32)27-36-39(34(3,4)5,30-20-15-13-16-21-30)31-22-17-14-18-23-31/h13-18,20-23,29,32-33H,6-12,19,24-27H2,1-5H3/t29-,32-,33+/m0/s1 |
| InChIKey | WQMIEESBQFXVES-QPWONNCLSA-N |
| XLogP | 7.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|