C16H28O4 — CID 56927485
[(2R,3S,6R)-6-(2-oxobutyl)-2-pentyloxan-3-yl] acetate (PubChem CID 56927485) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is [(2R,3S,6R)-6-(2-oxobutyl)-2-pentyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,6R)-6-(2-oxobutyl)-2-pentyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 56927485 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [(2R,3S,6R)-6-(2-oxobutyl)-2-pentyloxan-3-yl] acetate |
| SMILES | CCCCC[C@H]1O[C@@H](CC(=O)CC)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H28O4/c1-4-6-7-8-15-16(19-12(3)17)10-9-14(20-15)11-13(18)5-2/h14-16H,4-11H2,1-3H3/t14-,15-,16+/m1/s1 |
| InChIKey | OPMGIAKURQCVHW-OAGGEKHMSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|