C18H36O4 — CID 11023515
[(2S,5R,6S)-6-decyl-5-(methoxymethoxy)oxan-2-yl]methanol (PubChem CID 11023515) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is [(2S,5R,6S)-6-decyl-5-(methoxymethoxy)oxan-2-yl]methanol.
| Compound Name | [(2S,5R,6S)-6-decyl-5-(methoxymethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 11023515 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | [(2S,5R,6S)-6-decyl-5-(methoxymethoxy)oxan-2-yl]methanol |
| SMILES | CCCCCCCCCC[C@@H]1O[C@H](CO)CC[C@H]1OCOC |
| InChI | InChI=1S/C18H36O4/c1-3-4-5-6-7-8-9-10-11-18-17(21-15-20-2)13-12-16(14-19)22-18/h16-19H,3-15H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | VGELXNMOYKOURQ-KSZLIROESA-N |
| XLogP | 4.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|