About sodium;hydride;(2-pentylcyclobutyl) acetate
sodium;hydride;(2-pentylcyclobutyl) acetate (PubChem CID 175295819) has the molecular formula C11H21NaO2
and a molecular weight of 208.28 g/mol. Its IUPAC name is sodium;hydride;(2-pentylcyclobutyl) acetate.
Molecular Properties
| Compound Name | sodium;hydride;(2-pentylcyclobutyl) acetate |
| PubChem CID | 175295819 |
| Molecular Formula | C11H21NaO2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | sodium;hydride;(2-pentylcyclobutyl) acetate |
| SMILES | CCCCCC1CCC1OC(C)=O.[H-].[Na+] |
| InChI | InChI=1S/C11H20O2.Na.H/c1-3-4-5-6-10-7-8-11(10)13-9(2)12;;/h10-11H,3-8H2,1-2H3;;/q;+1;-1 |
| InChIKey | KQIILTWHWZPEKL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(2-pentylcyclobutyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(2-pentylcyclobutyl) acetate?
The IUPAC name of sodium;hydride;(2-pentylcyclobutyl) acetate (CID 175295819) is sodium;hydride;(2-pentylcyclobutyl) acetate.
What is the SMILES notation for sodium;hydride;(2-pentylcyclobutyl) acetate?
The canonical SMILES for sodium;hydride;(2-pentylcyclobutyl) acetate is CCCCCC1CCC1OC(C)=O.[H-].[Na+].
What is the InChIKey of sodium;hydride;(2-pentylcyclobutyl) acetate?
The InChIKey is KQIILTWHWZPEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.Na.H/c1-3-4-5-6-10-7-8-11(10)13-9(2)12;;/h10-11H,3-8H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;(2-pentylcyclobutyl) acetate?
sodium;hydride;(2-pentylcyclobutyl) acetate has a molecular weight of 208.28 g/mol, XLogP of 0.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(2-pentylcyclobutyl) acetate is sourced from PubChem (CID 175295819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).